C27H31F4NO7S2 — CID 146802664
(1,1,1-trifluoro-2-methylpropan-2-yl) 2-[(2S)-2-[2-(2-ethylcyclopropyl)sulfonylethyl]-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]acetate (PubChem CID 146802664) has the molecular formula C27H31F4NO7S2 and a molecular weight of 621.67 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-methylpropan-2-yl) 2-[(2S)-2-[2-(2-ethylcyclopropyl)sulfonylethyl]-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]acetate.
| Compound Name | (1,1,1-trifluoro-2-methylpropan-2-yl) 2-[(2S)-2-[2-(2-ethylcyclopropyl)sulfonylethyl]-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]acetate |
|---|---|
| PubChem CID | 146802664 |
| Molecular Formula | C27H31F4NO7S2 |
| Molecular Weight | 621.67 g/mol |
| Exact Mass | 621.15 |
| IUPAC Name | (1,1,1-trifluoro-2-methylpropan-2-yl) 2-[(2S)-2-[2-(2-ethylcyclopropyl)sulfonylethyl]-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]acetate |
| SMILES | CCC1CC1S(=O)(=O)CC[C@H]1CN(S(=O)(=O)c2ccc(F)cc2)c2cc(CC(=O)OC(C)(C)C(F)(F)F)ccc2O1 |
| InChI | InChI=1S/C27H31F4NO7S2/c1-4-18-15-24(18)40(34,35)12-11-20-16-32(41(36,37)21-8-6-19(28)7-9-21)22-13-17(5-10-23(22)38-20)14-25(33)39-26(2,3)27(29,30)31/h5-10,13,18,20,24H,4,11-12,14-16H2,1-3H3/t18?,20-,24?/m0/s1 |
| InChIKey | RYFJWQCSSXSTLT-WLBKGHODSA-N |
| XLogP | 4.81 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.67 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |