C29H30N4OS — CID 146802908
2-(2-amino-5-thiophen-2-ylphenyl)-1-[2-[(1-methyl-4-phenylpiperidin-4-yl)methyl]pyrimidin-5-yl]ethanone (PubChem CID 146802908) has the molecular formula C29H30N4OS and a molecular weight of 482.65 g/mol. Its IUPAC name is 2-(2-amino-5-thiophen-2-ylphenyl)-1-[2-[(1-methyl-4-phenylpiperidin-4-yl)methyl]pyrimidin-5-yl]ethanone.
| Compound Name | 2-(2-amino-5-thiophen-2-ylphenyl)-1-[2-[(1-methyl-4-phenylpiperidin-4-yl)methyl]pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 146802908 |
| Molecular Formula | C29H30N4OS |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 2-(2-amino-5-thiophen-2-ylphenyl)-1-[2-[(1-methyl-4-phenylpiperidin-4-yl)methyl]pyrimidin-5-yl]ethanone |
| SMILES | CN1CCC(Cc2ncc(C(=O)Cc3cc(-c4cccs4)ccc3N)cn2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C29H30N4OS/c1-33-13-11-29(12-14-33,24-6-3-2-4-7-24)18-28-31-19-23(20-32-28)26(34)17-22-16-21(9-10-25(22)30)27-8-5-15-35-27/h2-10,15-16,19-20H,11-14,17-18,30H2,1H3 |
| InChIKey | RYGQGRLRZQADDX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|