C18H28ClN6O9PS — CID 146805026
[2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-methylsulfonylpropan-2-yl]phosphonic acid (PubChem CID 146805026) has the molecular formula C18H28ClN6O9PS and a molecular weight of 570.95 g/mol. Its IUPAC name is [2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-methylsulfonylpropan-2-yl]phosphonic acid.
| Compound Name | [2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-methylsulfonylpropan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 146805026 |
| Molecular Formula | C18H28ClN6O9PS |
| Molecular Weight | 570.95 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | [2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-methylsulfonylpropan-2-yl]phosphonic acid |
| SMILES | CC(CS(C)(=O)=O)(OC[C@H]1O[C@@H](n2nnc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C18H28ClN6O9PS/c1-18(35(28,29)30,8-36(2,31)32)33-7-10-12(26)13(27)16(34-10)25-15-11(23-24-25)14(21-17(19)22-15)20-9-5-3-4-6-9/h9-10,12-13,16,26-27H,3-8H2,1-2H3,(H,20,21,22)(H2,28,29,30)/t10-,12-,13-,16-,18?/m1/s1 |
| InChIKey | RYVXQATZAZPXCD-CMAHQRSQSA-N |
| XLogP | -0.20 |
| TPSA | 219.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.95 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|