C21H21F3N2O — CID 146805373
N-[[3-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine (PubChem CID 146805373) has the molecular formula C21H21F3N2O and a molecular weight of 374.41 g/mol. Its IUPAC name is N-[[3-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine.
| Compound Name | N-[[3-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine |
|---|---|
| PubChem CID | 146805373 |
| Molecular Formula | C21H21F3N2O |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N-[[3-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine |
| SMILES | FC(F)(F)c1cccc(C/N=C2\Nc3ccccc3CC23CCOCC3)c1 |
| InChI | InChI=1S/C21H21F3N2O/c22-21(23,24)17-6-3-4-15(12-17)14-25-19-20(8-10-27-11-9-20)13-16-5-1-2-7-18(16)26-19/h1-7,12H,8-11,13-14H2,(H,25,26) |
| InChIKey | RYXOXTPDORPELU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|