C24H37ClF2N4O4 — CID 146806166
N-[4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-3-hydroxy-1-bicyclo[2.2.2]octanyl]-6-fluoro-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 146806166) has the molecular formula C24H37ClF2N4O4 and a molecular weight of 519.03 g/mol. Its IUPAC name is N-[4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-3-hydroxy-1-bicyclo[2.2.2]octanyl]-6-fluoro-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-3-hydroxy-1-bicyclo[2.2.2]octanyl]-6-fluoro-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 146806166 |
| Molecular Formula | C24H37ClF2N4O4 |
| Molecular Weight | 519.03 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | N-[4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-3-hydroxy-1-bicyclo[2.2.2]octanyl]-6-fluoro-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | O=C(COC1CCC(Cl)C(F)C1)NC12CCC(NC(=O)C3CN4CC(F)CCC4N3)(CC1)CC2O |
| InChI | InChI=1S/C24H37ClF2N4O4/c25-16-3-2-15(9-17(16)27)35-13-21(33)29-24-7-5-23(6-8-24,10-19(24)32)30-22(34)18-12-31-11-14(26)1-4-20(31)28-18/h14-20,28,32H,1-13H2,(H,29,33)(H,30,34) |
| InChIKey | XXTPSHYTHIFEQQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.03 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|