C8H6NO3+ — CID 146808878
3a,7a-dihydro-4,7-epoxyisoindol-2-ium-1,3-dione (PubChem CID 146808878) has the molecular formula C8H6NO3+ and a molecular weight of 164.14 g/mol. Its IUPAC name is 3a,7a-dihydro-4,7-epoxyisoindol-2-ium-1,3-dione.
| Compound Name | 3a,7a-dihydro-4,7-epoxyisoindol-2-ium-1,3-dione |
|---|---|
| PubChem CID | 146808878 |
| Molecular Formula | C8H6NO3+ |
| Molecular Weight | 164.14 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | 3a,7a-dihydro-4,7-epoxyisoindol-2-ium-1,3-dione |
| SMILES | O=C1[NH2+]C(=O)C2c3ccc(o3)C12 |
| InChI | InChI=1S/C8H5NO3/c10-7-5-3-1-2-4(12-3)6(5)8(11)9-7/h1-2,5-6H,(H,9,10,11)/p+1 |
| InChIKey | RZQSJDXAPAKEGK-UHFFFAOYSA-O |
| XLogP | -0.91 |
| TPSA | 63.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.14 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|