C25H19FN6O2S — CID 146809122
2-fluoro-4-[7-(6-isocyano-5-methyl-3-pyridinyl)-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]-N-pyridin-3-ylbenzamide (PubChem CID 146809122) has the molecular formula C25H19FN6O2S and a molecular weight of 486.53 g/mol. Its IUPAC name is 2-fluoro-4-[7-(6-isocyano-5-methyl-3-pyridinyl)-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]-N-pyridin-3-ylbenzamide.
| Compound Name | 2-fluoro-4-[7-(6-isocyano-5-methyl-3-pyridinyl)-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]-N-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 146809122 |
| Molecular Formula | C25H19FN6O2S |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 2-fluoro-4-[7-(6-isocyano-5-methyl-3-pyridinyl)-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]-N-pyridin-3-ylbenzamide |
| SMILES | [C-]#[N+]c1ncc(N2C(=O)C3(CCC3)N(c3ccc(C(=O)Nc4cccnc4)c(F)c3)C2=S)cc1C |
| InChI | InChI=1S/C25H19FN6O2S/c1-15-11-18(14-29-21(15)27-2)31-23(34)25(8-4-9-25)32(24(31)35)17-6-7-19(20(26)12-17)22(33)30-16-5-3-10-28-13-16/h3,5-7,10-14H,4,8-9H2,1H3,(H,30,33) |
| InChIKey | RZRYNKRWCFFGTN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|