About (5-fluoro-2,4,4-trimethylpentan-2-yl) acetate
(5-fluoro-2,4,4-trimethylpentan-2-yl) acetate (PubChem CID 146813333) has the molecular formula C10H19FO2
and a molecular weight of 190.26 g/mol. Its IUPAC name is (5-fluoro-2,4,4-trimethylpentan-2-yl) acetate.
Molecular Properties
| Compound Name | (5-fluoro-2,4,4-trimethylpentan-2-yl) acetate |
| PubChem CID | 146813333 |
| Molecular Formula | C10H19FO2 |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (5-fluoro-2,4,4-trimethylpentan-2-yl) acetate |
| SMILES | CC(=O)OC(C)(C)CC(C)(C)CF |
| InChI | InChI=1S/C10H19FO2/c1-8(12)13-10(4,5)6-9(2,3)7-11/h6-7H2,1-5H3 |
| InChIKey | SAOYICSTEWXKLR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-fluoro-2,4,4-trimethylpentan-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-2,4,4-trimethylpentan-2-yl) acetate?
The IUPAC name of (5-fluoro-2,4,4-trimethylpentan-2-yl) acetate (CID 146813333) is (5-fluoro-2,4,4-trimethylpentan-2-yl) acetate.
What is the SMILES notation for (5-fluoro-2,4,4-trimethylpentan-2-yl) acetate?
The canonical SMILES for (5-fluoro-2,4,4-trimethylpentan-2-yl) acetate is CC(=O)OC(C)(C)CC(C)(C)CF.
What is the InChIKey of (5-fluoro-2,4,4-trimethylpentan-2-yl) acetate?
The InChIKey is SAOYICSTEWXKLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19FO2/c1-8(12)13-10(4,5)6-9(2,3)7-11/h6-7H2,1-5H3.
What are the key properties of (5-fluoro-2,4,4-trimethylpentan-2-yl) acetate?
(5-fluoro-2,4,4-trimethylpentan-2-yl) acetate has a molecular weight of 190.26 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-2,4,4-trimethylpentan-2-yl) acetate is sourced from PubChem (CID 146813333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).