C17H30O — CID 14681522
(2R,3S)-2-ethyl-3-[(2Z,5Z)-trideca-2,5-dienyl]oxirane (PubChem CID 14681522) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is (2R,3S)-2-ethyl-3-[(2Z,5Z)-trideca-2,5-dienyl]oxirane.
| Compound Name | (2R,3S)-2-ethyl-3-[(2Z,5Z)-trideca-2,5-dienyl]oxirane |
|---|---|
| PubChem CID | 14681522 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | (2R,3S)-2-ethyl-3-[(2Z,5Z)-trideca-2,5-dienyl]oxirane |
| SMILES | CCCCCCC/C=C\C/C=C\C[C@@H]1O[C@@H]1CC |
| InChI | InChI=1S/C17H30O/c1-3-5-6-7-8-9-10-11-12-13-14-15-17-16(4-2)18-17/h10-11,13-14,16-17H,3-9,12,15H2,1-2H3/b11-10-,14-13-/t16-,17+/m1/s1 |
| InChIKey | VDCIZKQRWVMECW-DDHUGVIXSA-N |
| XLogP | 5.42 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|