C56H39N3OSi — CID 146815382
N-[3-(5,6-diphenyl-11H-indolo[2,3-b][1,4]benzazasilin-2-yl)phenyl]-N-(3-phenylphenyl)dibenzofuran-3-amine (PubChem CID 146815382) has the molecular formula C56H39N3OSi and a molecular weight of 798.03 g/mol. Its IUPAC name is N-[3-(5,6-diphenyl-11H-indolo[2,3-b][1,4]benzazasilin-2-yl)phenyl]-N-(3-phenylphenyl)dibenzofuran-3-amine.
| Compound Name | N-[3-(5,6-diphenyl-11H-indolo[2,3-b][1,4]benzazasilin-2-yl)phenyl]-N-(3-phenylphenyl)dibenzofuran-3-amine |
|---|---|
| PubChem CID | 146815382 |
| Molecular Formula | C56H39N3OSi |
| Molecular Weight | 798.03 g/mol |
| Exact Mass | 797.29 |
| IUPAC Name | N-[3-(5,6-diphenyl-11H-indolo[2,3-b][1,4]benzazasilin-2-yl)phenyl]-N-(3-phenylphenyl)dibenzofuran-3-amine |
| SMILES | c1ccc(-c2cccc(N(c3cccc(-c4ccc5c(c4)[SiH2]c4c(n(-c6ccccc6)c6ccccc46)N5c4ccccc4)c3)c3ccc4c(c3)oc3ccccc34)c2)cc1 |
| InChI | InChI=1S/C56H39N3OSi/c1-4-16-38(17-5-1)39-18-14-24-44(34-39)57(46-31-32-48-47-26-11-13-29-52(47)60-53(48)37-46)45-25-15-19-40(35-45)41-30-33-51-54(36-41)61-55-49-27-10-12-28-50(49)58(42-20-6-2-7-21-42)56(55)59(51)43-22-8-3-9-23-43/h1-37H,61H2 |
| InChIKey | SAZFDUHTFSCRLM-UHFFFAOYSA-N |
| XLogP | 13.24 |
| TPSA | 24.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.03 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|