About pyrrolidin-1-yl morpholine-4-carboximidothioate
pyrrolidin-1-yl morpholine-4-carboximidothioate (PubChem CID 146817389) has the molecular formula C9H17N3OS
and a molecular weight of 215.32 g/mol. Its IUPAC name is pyrrolidin-1-yl morpholine-4-carboximidothioate.
Molecular Properties
| Compound Name | pyrrolidin-1-yl morpholine-4-carboximidothioate |
| PubChem CID | 146817389 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | pyrrolidin-1-yl morpholine-4-carboximidothioate |
| SMILES | [H]/N=C(/SN1CCCC1)N1CCOCC1 |
| InChI | InChI=1S/C9H17N3OS/c10-9(11-5-7-13-8-6-11)14-12-3-1-2-4-12/h10H,1-8H2/b10-9+ |
| InChIKey | SBJGPJMWBPNETN-MDZDMXLPSA-N |
| XLogP | 1.00 |
| TPSA | 39.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze pyrrolidin-1-yl morpholine-4-carboximidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-1-yl morpholine-4-carboximidothioate?
The IUPAC name of pyrrolidin-1-yl morpholine-4-carboximidothioate (CID 146817389) is pyrrolidin-1-yl morpholine-4-carboximidothioate.
What is the SMILES notation for pyrrolidin-1-yl morpholine-4-carboximidothioate?
The canonical SMILES for pyrrolidin-1-yl morpholine-4-carboximidothioate is [H]/N=C(/SN1CCCC1)N1CCOCC1.
What is the InChIKey of pyrrolidin-1-yl morpholine-4-carboximidothioate?
The InChIKey is SBJGPJMWBPNETN-MDZDMXLPSA-N. The full InChI is InChI=1S/C9H17N3OS/c10-9(11-5-7-13-8-6-11)14-12-3-1-2-4-12/h10H,1-8H2/b10-9+.
What are the key properties of pyrrolidin-1-yl morpholine-4-carboximidothioate?
pyrrolidin-1-yl morpholine-4-carboximidothioate has a molecular weight of 215.32 g/mol, XLogP of 1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-1-yl morpholine-4-carboximidothioate is sourced from PubChem (CID 146817389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).