C16H20O2 — CID 14681772
[(7R)-1-methyl-7-prop-1-en-2-yl-5,6,7,8-tetrahydronaphthalen-2-yl] acetate (PubChem CID 14681772) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is [(7R)-1-methyl-7-prop-1-en-2-yl-5,6,7,8-tetrahydronaphthalen-2-yl] acetate.
| Compound Name | [(7R)-1-methyl-7-prop-1-en-2-yl-5,6,7,8-tetrahydronaphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 14681772 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | [(7R)-1-methyl-7-prop-1-en-2-yl-5,6,7,8-tetrahydronaphthalen-2-yl] acetate |
| SMILES | C=C(C)[C@@H]1CCc2ccc(OC(C)=O)c(C)c2C1 |
| InChI | InChI=1S/C16H20O2/c1-10(2)14-6-5-13-7-8-16(18-12(4)17)11(3)15(13)9-14/h7-8,14H,1,5-6,9H2,2-4H3/t14-/m1/s1 |
| InChIKey | HNUDKGDGBHFVGV-CQSZACIVSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|