C32H33ClN8O2 — CID 146820679
5-[2-(4-aminophenyl)-9-methylpurin-6-yl]oxy-2-chloro-N-[3-methyl-4-[(4-methylpiperazin-1-yl)methyl]phenyl]benzamide (PubChem CID 146820679) has the molecular formula C32H33ClN8O2 and a molecular weight of 597.12 g/mol. Its IUPAC name is 5-[2-(4-aminophenyl)-9-methylpurin-6-yl]oxy-2-chloro-N-[3-methyl-4-[(4-methylpiperazin-1-yl)methyl]phenyl]benzamide.
| Compound Name | 5-[2-(4-aminophenyl)-9-methylpurin-6-yl]oxy-2-chloro-N-[3-methyl-4-[(4-methylpiperazin-1-yl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 146820679 |
| Molecular Formula | C32H33ClN8O2 |
| Molecular Weight | 597.12 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | 5-[2-(4-aminophenyl)-9-methylpurin-6-yl]oxy-2-chloro-N-[3-methyl-4-[(4-methylpiperazin-1-yl)methyl]phenyl]benzamide |
| SMILES | Cc1cc(NC(=O)c2cc(Oc3nc(-c4ccc(N)cc4)nc4c3ncn4C)ccc2Cl)ccc1CN1CCN(C)CC1 |
| InChI | InChI=1S/C32H33ClN8O2/c1-20-16-24(9-6-22(20)18-41-14-12-39(2)13-15-41)36-31(42)26-17-25(10-11-27(26)33)43-32-28-30(40(3)19-35-28)37-29(38-32)21-4-7-23(34)8-5-21/h4-11,16-17,19H,12-15,18,34H2,1-3H3,(H,36,42) |
| InChIKey | SBZBNDUHGYNJBA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.12 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|