About 3-(3,4-dichlorophenyl)imino-1-[5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]indol-2-one
3-(3,4-dichlorophenyl)imino-1-[5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]indol-2-one (PubChem CID 146823219) has the molecular formula C21H13Cl2F3N2O
and a molecular weight of 437.25 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)imino-1-[5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]indol-2-one.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenyl)imino-1-[5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]indol-2-one |
| PubChem CID | 146823219 |
| Molecular Formula | C21H13Cl2F3N2O |
| Molecular Weight | 437.25 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 3-(3,4-dichlorophenyl)imino-1-[5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]indol-2-one |
| SMILES | O=C1/C(=N/c2ccc(Cl)c(Cl)c2)c2ccccc2N1C1=CC=CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C21H13Cl2F3N2O/c22-16-9-8-13(11-17(16)23)27-19-15-6-1-2-7-18(15)28(20(19)29)14-5-3-4-12(10-14)21(24,25)26/h1-9,11-12H,10H2/b27-19+ |
| InChIKey | SCLGWCRUOXBZJQ-ZXVVBBHZSA-N |
| XLogP | 6.48 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.25 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dichlorophenyl)imino-1-[5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenyl)imino-1-[5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]indol-2-one?
The IUPAC name of 3-(3,4-dichlorophenyl)imino-1-[5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]indol-2-one (CID 146823219) is 3-(3,4-dichlorophenyl)imino-1-[5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]indol-2-one.
What is the SMILES notation for 3-(3,4-dichlorophenyl)imino-1-[5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]indol-2-one?
The canonical SMILES for 3-(3,4-dichlorophenyl)imino-1-[5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]indol-2-one is O=C1/C(=N/c2ccc(Cl)c(Cl)c2)c2ccccc2N1C1=CC=CC(C(F)(F)F)C1.
What is the InChIKey of 3-(3,4-dichlorophenyl)imino-1-[5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]indol-2-one?
The InChIKey is SCLGWCRUOXBZJQ-ZXVVBBHZSA-N. The full InChI is InChI=1S/C21H13Cl2F3N2O/c22-16-9-8-13(11-17(16)23)27-19-15-6-1-2-7-18(15)28(20(19)29)14-5-3-4-12(10-14)21(24,25)26/h1-9,11-12H,10H2/b27-19+.
What are the key properties of 3-(3,4-dichlorophenyl)imino-1-[5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]indol-2-one?
3-(3,4-dichlorophenyl)imino-1-[5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]indol-2-one has a molecular weight of 437.25 g/mol, XLogP of 6.48, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenyl)imino-1-[5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]indol-2-one is sourced from PubChem (CID 146823219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).