C15H20F4O5 — CID 146824894
(3R,4S,5S,7S)-7-fluoro-5-methoxy-4-[(2S,3R)-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxiran-2-yl]-1-oxaspiro[2.5]octan-6-one (PubChem CID 146824894) has the molecular formula C15H20F4O5 and a molecular weight of 356.31 g/mol. Its IUPAC name is (3R,4S,5S,7S)-7-fluoro-5-methoxy-4-[(2S,3R)-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxiran-2-yl]-1-oxaspiro[2.5]octan-6-one.
| Compound Name | (3R,4S,5S,7S)-7-fluoro-5-methoxy-4-[(2S,3R)-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxiran-2-yl]-1-oxaspiro[2.5]octan-6-one |
|---|---|
| PubChem CID | 146824894 |
| Molecular Formula | C15H20F4O5 |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (3R,4S,5S,7S)-7-fluoro-5-methoxy-4-[(2S,3R)-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxiran-2-yl]-1-oxaspiro[2.5]octan-6-one |
| SMILES | CO[C@@H]1C(=O)[C@@H](F)C[C@]2(CO2)[C@H]1[C@]1(C)O[C@@H]1CCOCC(F)(F)F |
| InChI | InChI=1S/C15H20F4O5/c1-13(9(24-13)3-4-22-7-15(17,18)19)12-11(21-2)10(20)8(16)5-14(12)6-23-14/h8-9,11-12H,3-7H2,1-2H3/t8-,9+,11+,12+,13+,14-/m0/s1 |
| InChIKey | SCTVQHJLPMFIFR-DKJIJZLBSA-N |
| XLogP | 1.82 |
| TPSA | 60.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|