C21H22N2O3 — CID 14682588
1-[(5S)-5-benzyl-2,2,3-trimethyl-4-oxoimidazolidin-1-yl]-2-phenylethane-1,2-dione (PubChem CID 14682588) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-[(5S)-5-benzyl-2,2,3-trimethyl-4-oxoimidazolidin-1-yl]-2-phenylethane-1,2-dione.
| Compound Name | 1-[(5S)-5-benzyl-2,2,3-trimethyl-4-oxoimidazolidin-1-yl]-2-phenylethane-1,2-dione |
|---|---|
| PubChem CID | 14682588 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1-[(5S)-5-benzyl-2,2,3-trimethyl-4-oxoimidazolidin-1-yl]-2-phenylethane-1,2-dione |
| SMILES | CN1C(=O)[C@H](Cc2ccccc2)N(C(=O)C(=O)c2ccccc2)C1(C)C |
| InChI | InChI=1S/C21H22N2O3/c1-21(2)22(3)19(25)17(14-15-10-6-4-7-11-15)23(21)20(26)18(24)16-12-8-5-9-13-16/h4-13,17H,14H2,1-3H3/t17-/m0/s1 |
| InChIKey | DTILSBHOPKSQMB-KRWDZBQOSA-N |
| XLogP | 2.52 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|