C11H20O3Si — CID 14682670
[(1Z,3E)-1-(1,3-dioxolan-2-yl)penta-1,3-dien-2-yl]oxy-trimethylsilane (PubChem CID 14682670) has the molecular formula C11H20O3Si and a molecular weight of 228.36 g/mol. Its IUPAC name is [(1Z,3E)-1-(1,3-dioxolan-2-yl)penta-1,3-dien-2-yl]oxy-trimethylsilane.
| Compound Name | [(1Z,3E)-1-(1,3-dioxolan-2-yl)penta-1,3-dien-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 14682670 |
| Molecular Formula | C11H20O3Si |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | [(1Z,3E)-1-(1,3-dioxolan-2-yl)penta-1,3-dien-2-yl]oxy-trimethylsilane |
| SMILES | C/C=C/C(=C/C1OCCO1)O[Si](C)(C)C |
| InChI | InChI=1S/C11H20O3Si/c1-5-6-10(14-15(2,3)4)9-11-12-7-8-13-11/h5-6,9,11H,7-8H2,1-4H3/b6-5+,10-9- |
| InChIKey | JVXPFWORSJRXKS-QMRMAQATSA-N |
| XLogP | 2.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|