About 1,2,5-oxadithiolane 2,5-dioxide
1,2,5-oxadithiolane 2,5-dioxide (PubChem CID 146827375) has the molecular formula C2H4O3S2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 1,2,5-oxadithiolane 2,5-dioxide.
Molecular Properties
| Compound Name | 1,2,5-oxadithiolane 2,5-dioxide |
| PubChem CID | 146827375 |
| Molecular Formula | C2H4O3S2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 139.96 |
| IUPAC Name | 1,2,5-oxadithiolane 2,5-dioxide |
| SMILES | O=S1CCS(=O)O1 |
| InChI | InChI=1S/C2H4O3S2/c3-6-1-2-7(4)5-6/h1-2H2 |
| InChIKey | SDFSQVXAMIEZQM-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2,5-oxadithiolane 2,5-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,5-oxadithiolane 2,5-dioxide?
The IUPAC name of 1,2,5-oxadithiolane 2,5-dioxide (CID 146827375) is 1,2,5-oxadithiolane 2,5-dioxide.
What is the SMILES notation for 1,2,5-oxadithiolane 2,5-dioxide?
The canonical SMILES for 1,2,5-oxadithiolane 2,5-dioxide is O=S1CCS(=O)O1.
What is the InChIKey of 1,2,5-oxadithiolane 2,5-dioxide?
The InChIKey is SDFSQVXAMIEZQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O3S2/c3-6-1-2-7(4)5-6/h1-2H2.
What are the key properties of 1,2,5-oxadithiolane 2,5-dioxide?
1,2,5-oxadithiolane 2,5-dioxide has a molecular weight of 140.18 g/mol, XLogP of -0.66, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,5-oxadithiolane 2,5-dioxide is sourced from PubChem (CID 146827375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).