C22H38O10 — CID 14682777
(2S,3R,4R,5R,6R)-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-(4-methylcyclohex-3-en-1-yl)propan-2-yloxy]oxan-2-yl]methoxy]oxane-3,4,5-triol (PubChem CID 14682777) has the molecular formula C22H38O10 and a molecular weight of 462.54 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-(4-methylcyclohex-3-en-1-yl)propan-2-yloxy]oxan-2-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R,6R)-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-(4-methylcyclohex-3-en-1-yl)propan-2-yloxy]oxan-2-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 14682777 |
| Molecular Formula | C22H38O10 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-(4-methylcyclohex-3-en-1-yl)propan-2-yloxy]oxan-2-yl]methoxy]oxane-3,4,5-triol |
| SMILES | CC1=CCC(C(C)(C)O[C@@H]2O[C@H](CO[C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)CC1 |
| InChI | InChI=1S/C22H38O10/c1-10-5-7-12(8-6-10)22(3,4)32-21-19(28)17(26)15(24)13(31-21)9-29-20-18(27)16(25)14(23)11(2)30-20/h5,11-21,23-28H,6-9H2,1-4H3/t11-,12?,13+,14-,15+,16+,17-,18+,19+,20+,21-/m0/s1 |
| InChIKey | JIDXOGPQCVBGSC-BXUICYMCSA-N |
| XLogP | -0.82 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|