C18H27N5O4S — CID 146828441
(3S)-3-[[2-amino-5-[(3,4-dimethoxy-2-pyridinyl)methoxy]pyrimidin-4-yl]amino]-3-sulfanylhexan-1-ol (PubChem CID 146828441) has the molecular formula C18H27N5O4S and a molecular weight of 409.51 g/mol. Its IUPAC name is (3S)-3-[[2-amino-5-[(3,4-dimethoxy-2-pyridinyl)methoxy]pyrimidin-4-yl]amino]-3-sulfanylhexan-1-ol.
| Compound Name | (3S)-3-[[2-amino-5-[(3,4-dimethoxy-2-pyridinyl)methoxy]pyrimidin-4-yl]amino]-3-sulfanylhexan-1-ol |
|---|---|
| PubChem CID | 146828441 |
| Molecular Formula | C18H27N5O4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (3S)-3-[[2-amino-5-[(3,4-dimethoxy-2-pyridinyl)methoxy]pyrimidin-4-yl]amino]-3-sulfanylhexan-1-ol |
| SMILES | CCC[C@](S)(CCO)Nc1nc(N)ncc1OCc1nccc(OC)c1OC |
| InChI | InChI=1S/C18H27N5O4S/c1-4-6-18(28,7-9-24)23-16-14(10-21-17(19)22-16)27-11-12-15(26-3)13(25-2)5-8-20-12/h5,8,10,24,28H,4,6-7,9,11H2,1-3H3,(H3,19,21,22,23)/t18-/m0/s1 |
| InChIKey | SDNOVYKJCOQBEC-SFHVURJKSA-N |
| XLogP | 2.27 |
| TPSA | 124.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|