About 4-[(1R,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enyl acetate
4-[(1R,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enyl acetate (PubChem CID 14682851) has the molecular formula C17H28O3
and a molecular weight of 280.41 g/mol. Its IUPAC name is 4-[(1R,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enyl acetate.
Molecular Properties
| Compound Name | 4-[(1R,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enyl acetate |
| PubChem CID | 14682851 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 4-[(1R,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enyl acetate |
| SMILES | C=C(CCCOC(C)=O)[C@@H]1CC(C)(C)[C@@H]1CCC(C)=O |
| InChI | InChI=1S/C17H28O3/c1-12(7-6-10-20-14(3)19)15-11-17(4,5)16(15)9-8-13(2)18/h15-16H,1,6-11H2,2-5H3/t15-,16+/m0/s1 |
| InChIKey | SEVDEWFDYJQPGB-JKSUJKDBSA-N |
| XLogP | 3.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1R,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1R,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enyl acetate?
The IUPAC name of 4-[(1R,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enyl acetate (CID 14682851) is 4-[(1R,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enyl acetate.
What is the SMILES notation for 4-[(1R,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enyl acetate?
The canonical SMILES for 4-[(1R,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enyl acetate is C=C(CCCOC(C)=O)[C@@H]1CC(C)(C)[C@@H]1CCC(C)=O.
What is the InChIKey of 4-[(1R,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enyl acetate?
The InChIKey is SEVDEWFDYJQPGB-JKSUJKDBSA-N. The full InChI is InChI=1S/C17H28O3/c1-12(7-6-10-20-14(3)19)15-11-17(4,5)16(15)9-8-13(2)18/h15-16H,1,6-11H2,2-5H3/t15-,16+/m0/s1.
What are the key properties of 4-[(1R,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enyl acetate?
4-[(1R,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enyl acetate has a molecular weight of 280.41 g/mol, XLogP of 3.92, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1R,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enyl acetate is sourced from PubChem (CID 14682851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).