About 2-(4-bromophenyl)-1-(2,2-difluoroethyl)-5-iodo-3H-pyridin-3-id-6-one;yttrium
2-(4-bromophenyl)-1-(2,2-difluoroethyl)-5-iodo-3H-pyridin-3-id-6-one;yttrium (PubChem CID 146828941) has the molecular formula C13H8BrF2INOY-
and a molecular weight of 527.92 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(2,2-difluoroethyl)-5-iodo-3H-pyridin-3-id-6-one;yttrium.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-1-(2,2-difluoroethyl)-5-iodo-3H-pyridin-3-id-6-one;yttrium |
| PubChem CID | 146828941 |
| Molecular Formula | C13H8BrF2INOY- |
| Molecular Weight | 527.92 g/mol |
| Exact Mass | 526.79 |
| IUPAC Name | 2-(4-bromophenyl)-1-(2,2-difluoroethyl)-5-iodo-3H-pyridin-3-id-6-one;yttrium |
| SMILES | O=c1c(I)c[c-]c(-c2ccc(Br)cc2)n1CC(F)F.[Y] |
| InChI | InChI=1S/C13H8BrF2INO.Y/c14-9-3-1-8(2-4-9)11-6-5-10(17)13(19)18(11)7-12(15)16;/h1-5,12H,7H2;/q-1; |
| InChIKey | SXDVCGYVSSXINA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 527.92 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromophenyl)-1-(2,2-difluoroethyl)-5-iodo-3H-pyridin-3-id-6-one;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-1-(2,2-difluoroethyl)-5-iodo-3H-pyridin-3-id-6-one;yttrium?
The IUPAC name of 2-(4-bromophenyl)-1-(2,2-difluoroethyl)-5-iodo-3H-pyridin-3-id-6-one;yttrium (CID 146828941) is 2-(4-bromophenyl)-1-(2,2-difluoroethyl)-5-iodo-3H-pyridin-3-id-6-one;yttrium.
What is the SMILES notation for 2-(4-bromophenyl)-1-(2,2-difluoroethyl)-5-iodo-3H-pyridin-3-id-6-one;yttrium?
The canonical SMILES for 2-(4-bromophenyl)-1-(2,2-difluoroethyl)-5-iodo-3H-pyridin-3-id-6-one;yttrium is O=c1c(I)c[c-]c(-c2ccc(Br)cc2)n1CC(F)F.[Y].
What is the InChIKey of 2-(4-bromophenyl)-1-(2,2-difluoroethyl)-5-iodo-3H-pyridin-3-id-6-one;yttrium?
The InChIKey is SXDVCGYVSSXINA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrF2INO.Y/c14-9-3-1-8(2-4-9)11-6-5-10(17)13(19)18(11)7-12(15)16;/h1-5,12H,7H2;/q-1;.
What are the key properties of 2-(4-bromophenyl)-1-(2,2-difluoroethyl)-5-iodo-3H-pyridin-3-id-6-one;yttrium?
2-(4-bromophenyl)-1-(2,2-difluoroethyl)-5-iodo-3H-pyridin-3-id-6-one;yttrium has a molecular weight of 527.92 g/mol, XLogP of 3.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-1-(2,2-difluoroethyl)-5-iodo-3H-pyridin-3-id-6-one;yttrium is sourced from PubChem (CID 146828941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).