About (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-thiophen-2-ylprop-2-en-1-one
(E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 14683312) has the molecular formula C17H14O5S
and a molecular weight of 330.36 g/mol. Its IUPAC name is (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-thiophen-2-ylprop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-thiophen-2-ylprop-2-en-1-one |
| PubChem CID | 14683312 |
| Molecular Formula | C17H14O5S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | COc1c(C(=O)/C=C/c2cccs2)c(O)c(OC)c2occc12 |
| InChI | InChI=1S/C17H14O5S/c1-20-15-11-7-8-22-16(11)17(21-2)14(19)13(15)12(18)6-5-10-4-3-9-23-10/h3-9,19H,1-2H3/b6-5+ |
| InChIKey | RAZSHACBCXIZDA-AATRIKPKSA-N |
| XLogP | 4.11 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-thiophen-2-ylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-thiophen-2-ylprop-2-en-1-one?
The IUPAC name of (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-thiophen-2-ylprop-2-en-1-one (CID 14683312) is (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-thiophen-2-ylprop-2-en-1-one.
What is the SMILES notation for (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-thiophen-2-ylprop-2-en-1-one?
The canonical SMILES for (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-thiophen-2-ylprop-2-en-1-one is COc1c(C(=O)/C=C/c2cccs2)c(O)c(OC)c2occc12.
What is the InChIKey of (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-thiophen-2-ylprop-2-en-1-one?
The InChIKey is RAZSHACBCXIZDA-AATRIKPKSA-N. The full InChI is InChI=1S/C17H14O5S/c1-20-15-11-7-8-22-16(11)17(21-2)14(19)13(15)12(18)6-5-10-4-3-9-23-10/h3-9,19H,1-2H3/b6-5+.
What are the key properties of (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-thiophen-2-ylprop-2-en-1-one?
(E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-thiophen-2-ylprop-2-en-1-one has a molecular weight of 330.36 g/mol, XLogP of 4.11, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-thiophen-2-ylprop-2-en-1-one is sourced from PubChem (CID 14683312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).