C9H13NO — CID 146836956
3-methoxy-1-methylcyclohepta-2,4,6-trien-1-amine (PubChem CID 146836956) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 3-methoxy-1-methylcyclohepta-2,4,6-trien-1-amine.
| Compound Name | 3-methoxy-1-methylcyclohepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 146836956 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 3-methoxy-1-methylcyclohepta-2,4,6-trien-1-amine |
| SMILES | COC1=CC(C)(N)C=CC=C1 |
| InChI | InChI=1S/C9H13NO/c1-9(10)6-4-3-5-8(7-9)11-2/h3-7H,10H2,1-2H3 |
| InChIKey | SFHLEEBEFBPDAU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |