About CID 146840166
CID 146840166 (PubChem CID 146840166) has the molecular formula C11H5AlF3NO3
and a molecular weight of 283.14 g/mol.
Molecular Properties
| Compound Name | CID 146840166 |
| PubChem CID | 146840166 |
| Molecular Formula | C11H5AlF3NO3 |
| Molecular Weight | 283.14 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | — |
| SMILES | O=C(O)c1cc(=O)c2cc([Al])cc(C(F)(F)F)c2[nH]1 |
| InChI | InChI=1S/C11H5F3NO3.Al/c12-11(13,14)6-3-1-2-5-8(16)4-7(10(17)18)15-9(5)6;/h2-4H,(H,15,16)(H,17,18); |
| InChIKey | MIPLUNAVDUAERE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.14 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 146840166 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 146840166?
The IUPAC name of CID 146840166 (CID 146840166) is not available.
What is the SMILES notation for CID 146840166?
The canonical SMILES for CID 146840166 is O=C(O)c1cc(=O)c2cc([Al])cc(C(F)(F)F)c2[nH]1.
What is the InChIKey of CID 146840166?
The InChIKey is MIPLUNAVDUAERE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5F3NO3.Al/c12-11(13,14)6-3-1-2-5-8(16)4-7(10(17)18)15-9(5)6;/h2-4H,(H,15,16)(H,17,18);.
What are the key properties of CID 146840166?
CID 146840166 has a molecular weight of 283.14 g/mol, XLogP of 1.04, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 146840166 is sourced from PubChem (CID 146840166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).