C11H5AlF3NO3 — CID 146840166
CID 146840166 (PubChem CID 146840166) has the molecular formula C11H5AlF3NO3 and a molecular weight of 283.14 g/mol.
| Compound Name | CID 146840166 |
|---|---|
| PubChem CID | 146840166 |
| Molecular Formula | C11H5AlF3NO3 |
| Molecular Weight | 283.14 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | — |
| SMILES | O=C(O)c1cc(=O)c2cc([Al])cc(C(F)(F)F)c2[nH]1 |
| InChI | InChI=1S/C11H5F3NO3.Al/c12-11(13,14)6-3-1-2-5-8(16)4-7(10(17)18)15-9(5)6;/h2-4H,(H,15,16)(H,17,18); |
| InChIKey | MIPLUNAVDUAERE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.14 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |