C15H22N2O — CID 146840925
(1R,3S,10bS)-3-(2-methoxyethyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-1-amine (PubChem CID 146840925) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is (1R,3S,10bS)-3-(2-methoxyethyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-1-amine.
| Compound Name | (1R,3S,10bS)-3-(2-methoxyethyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-1-amine |
|---|---|
| PubChem CID | 146840925 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | (1R,3S,10bS)-3-(2-methoxyethyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-1-amine |
| SMILES | COCC[C@@H]1C[C@@H](N)[C@@H]2c3ccccc3CCN12 |
| InChI | InChI=1S/C15H22N2O/c1-18-9-7-12-10-14(16)15-13-5-3-2-4-11(13)6-8-17(12)15/h2-5,12,14-15H,6-10,16H2,1H3/t12-,14-,15+/m1/s1 |
| InChIKey | SGCUMLHUHJECDC-YUELXQCFSA-N |
| XLogP | 1.72 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |