C20H24N6O3 — CID 146842205
(Z)-2-amino-3-[amino(benzyl)amino]-N-[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]prop-2-enamide (PubChem CID 146842205) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino(benzyl)amino]-N-[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]prop-2-enamide.
| Compound Name | (Z)-2-amino-3-[amino(benzyl)amino]-N-[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 146842205 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | (Z)-2-amino-3-[amino(benzyl)amino]-N-[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]prop-2-enamide |
| SMILES | C[C@H]1Oc2cccnc2N(C)C(=O)[C@H]1NC(=O)/C(N)=C/N(N)Cc1ccccc1 |
| InChI | InChI=1S/C20H24N6O3/c1-13-17(20(28)25(2)18-16(29-13)9-6-10-23-18)24-19(27)15(21)12-26(22)11-14-7-4-3-5-8-14/h3-10,12-13,17H,11,21-22H2,1-2H3,(H,24,27)/b15-12-/t13-,17+/m1/s1 |
| InChIKey | SGJDUODKLSVQLA-OPUJDYAISA-N |
| XLogP | 0.49 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|