C17H25ClN5O8P — CID 146844063
[1-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-hydroxyethyl]phosphonic acid (PubChem CID 146844063) has the molecular formula C17H25ClN5O8P and a molecular weight of 493.84 g/mol. Its IUPAC name is [1-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-hydroxyethyl]phosphonic acid.
| Compound Name | [1-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-hydroxyethyl]phosphonic acid |
|---|---|
| PubChem CID | 146844063 |
| Molecular Formula | C17H25ClN5O8P |
| Molecular Weight | 493.84 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | [1-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-hydroxyethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(CO)OC[C@H]1O[C@@H](n2nnc3c(NC4CCCC4)cc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H25ClN5O8P/c18-11-5-9(19-8-3-1-2-4-8)13-16(20-11)23(22-21-13)17-15(26)14(25)10(31-17)7-30-12(6-24)32(27,28)29/h5,8,10,12,14-15,17,24-26H,1-4,6-7H2,(H,19,20)(H2,27,28,29)/t10-,12?,14-,15-,17-/m1/s1 |
| InChIKey | SGSHWUFYDQRGOA-JRYJEZCZSA-N |
| XLogP | -0.03 |
| TPSA | 192.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.84 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|