C46H36BN3O3 — CID 146846072
2,6-dipyridin-2-yl-4-[7'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[fluorene-9,9'-xanthene]-2'-yl]pyridine (PubChem CID 146846072) has the molecular formula C46H36BN3O3 and a molecular weight of 689.62 g/mol. Its IUPAC name is 2,6-dipyridin-2-yl-4-[7'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[fluorene-9,9'-xanthene]-2'-yl]pyridine.
| Compound Name | 2,6-dipyridin-2-yl-4-[7'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[fluorene-9,9'-xanthene]-2'-yl]pyridine |
|---|---|
| PubChem CID | 146846072 |
| Molecular Formula | C46H36BN3O3 |
| Molecular Weight | 689.62 g/mol |
| Exact Mass | 689.28 |
| IUPAC Name | 2,6-dipyridin-2-yl-4-[7'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[fluorene-9,9'-xanthene]-2'-yl]pyridine |
| SMILES | CC1(C)OB(c2ccc3c(c2)C2(c4cc(-c5cc(-c6ccccn6)nc(-c6ccccn6)c5)ccc4O3)c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C46H36BN3O3/c1-44(2)45(3,4)53-47(52-44)31-20-22-43-37(28-31)46(34-15-7-5-13-32(34)33-14-6-8-16-35(33)46)36-25-29(19-21-42(36)51-43)30-26-40(38-17-9-11-23-48-38)50-41(27-30)39-18-10-12-24-49-39/h5-28H,1-4H3 |
| InChIKey | SHCHURVWAZJJRS-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.62 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|