About 3-Cyclopentenol tetrahydropyranyl ether
3-Cyclopentenol tetrahydropyranyl ether (PubChem CID 14684775) has the molecular formula C10H16O2
and a molecular weight of 168.23 g/mol. Its IUPAC name is 2-cyclopent-3-en-1-yloxyoxane.
Molecular Properties
| Compound Name | 3-Cyclopentenol tetrahydropyranyl ether |
| PubChem CID | 14684775 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.23 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2-cyclopent-3-en-1-yloxyoxane |
| SMILES | C1CCOC(C1)OC2CC=CC2 |
| InChI | InChI=1S/C10H16O2/c1-2-6-9(5-1)12-10-7-3-4-8-11-10/h1-2,9-10H,3-8H2 |
| InChIKey | WOSQDNVHKIYAFD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 18.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | 157 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-Cyclopentenol tetrahydropyranyl ether with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-Cyclopentenol tetrahydropyranyl ether?
The IUPAC name of 3-Cyclopentenol tetrahydropyranyl ether (CID 14684775) is 2-cyclopent-3-en-1-yloxyoxane.
What is the SMILES notation for 3-Cyclopentenol tetrahydropyranyl ether?
The canonical SMILES for 3-Cyclopentenol tetrahydropyranyl ether is C1CCOC(C1)OC2CC=CC2.
What is the InChIKey of 3-Cyclopentenol tetrahydropyranyl ether?
The InChIKey is WOSQDNVHKIYAFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-2-6-9(5-1)12-10-7-3-4-8-11-10/h1-2,9-10H,3-8H2.
What are the key properties of 3-Cyclopentenol tetrahydropyranyl ether?
3-Cyclopentenol tetrahydropyranyl ether has a molecular weight of 168.23 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-Cyclopentenol tetrahydropyranyl ether is sourced from PubChem (CID 14684775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).