C25H31N5OS — CID 146855503
3-amino-N-[2-[4-(2,8-diazaspiro[4.5]decan-2-yl)phenyl]ethyl]-6-methylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 146855503) has the molecular formula C25H31N5OS and a molecular weight of 449.62 g/mol. Its IUPAC name is 3-amino-N-[2-[4-(2,8-diazaspiro[4.5]decan-2-yl)phenyl]ethyl]-6-methylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[2-[4-(2,8-diazaspiro[4.5]decan-2-yl)phenyl]ethyl]-6-methylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 146855503 |
| Molecular Formula | C25H31N5OS |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 3-amino-N-[2-[4-(2,8-diazaspiro[4.5]decan-2-yl)phenyl]ethyl]-6-methylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1ccc2c(N)c(C(=O)NCCc3ccc(N4CCC5(CCNCC5)C4)cc3)sc2n1 |
| InChI | InChI=1S/C25H31N5OS/c1-17-2-7-20-21(26)22(32-24(20)29-17)23(31)28-12-8-18-3-5-19(6-4-18)30-15-11-25(16-30)9-13-27-14-10-25/h2-7,27H,8-16,26H2,1H3,(H,28,31) |
| InChIKey | SJNAJAYRJRARNU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|