About ethanimidoyl(4,4,4-trifluorobutyl)azanium
ethanimidoyl(4,4,4-trifluorobutyl)azanium (PubChem CID 146855808) has the molecular formula C6H12F3N2+
and a molecular weight of 169.17 g/mol. Its IUPAC name is ethanimidoyl(4,4,4-trifluorobutyl)azanium.
Molecular Properties
| Compound Name | ethanimidoyl(4,4,4-trifluorobutyl)azanium |
| PubChem CID | 146855808 |
| Molecular Formula | C6H12F3N2+ |
| Molecular Weight | 169.17 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | ethanimidoyl(4,4,4-trifluorobutyl)azanium |
| SMILES | [H]/N=C(\C)[NH2+]CCCC(F)(F)F |
| InChI | InChI=1S/C6H11F3N2/c1-5(10)11-4-2-3-6(7,8)9/h2-4H2,1H3,(H2,10,11)/p+1 |
| InChIKey | SJOLOBIQQZFYPK-UHFFFAOYSA-O |
| XLogP | 0.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.17 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethanimidoyl(4,4,4-trifluorobutyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanimidoyl(4,4,4-trifluorobutyl)azanium?
The IUPAC name of ethanimidoyl(4,4,4-trifluorobutyl)azanium (CID 146855808) is ethanimidoyl(4,4,4-trifluorobutyl)azanium.
What is the SMILES notation for ethanimidoyl(4,4,4-trifluorobutyl)azanium?
The canonical SMILES for ethanimidoyl(4,4,4-trifluorobutyl)azanium is [H]/N=C(\C)[NH2+]CCCC(F)(F)F.
What is the InChIKey of ethanimidoyl(4,4,4-trifluorobutyl)azanium?
The InChIKey is SJOLOBIQQZFYPK-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H11F3N2/c1-5(10)11-4-2-3-6(7,8)9/h2-4H2,1H3,(H2,10,11)/p+1.
What are the key properties of ethanimidoyl(4,4,4-trifluorobutyl)azanium?
ethanimidoyl(4,4,4-trifluorobutyl)azanium has a molecular weight of 169.17 g/mol, XLogP of 0.89, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethanimidoyl(4,4,4-trifluorobutyl)azanium is sourced from PubChem (CID 146855808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).