C12H12N6 — CID 14685674
5-(3-aminophenyl)-8-methyl-[1,2,4]triazolo[1,5-c]pyrimidin-2-amine (PubChem CID 14685674) has the molecular formula C12H12N6 and a molecular weight of 240.27 g/mol. Its IUPAC name is 5-(3-aminophenyl)-8-methyl-[1,2,4]triazolo[1,5-c]pyrimidin-2-amine.
| Compound Name | 5-(3-aminophenyl)-8-methyl-[1,2,4]triazolo[1,5-c]pyrimidin-2-amine |
|---|---|
| PubChem CID | 14685674 |
| Molecular Formula | C12H12N6 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 5-(3-aminophenyl)-8-methyl-[1,2,4]triazolo[1,5-c]pyrimidin-2-amine |
| SMILES | Cc1cnc(-c2cccc(N)c2)n2nc(N)nc12 |
| InChI | InChI=1S/C12H12N6/c1-7-6-15-11(8-3-2-4-9(13)5-8)18-10(7)16-12(14)17-18/h2-6H,13H2,1H3,(H2,14,17) |
| InChIKey | IEZGKJGOYBOYSH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|