C22H22ClF3N2 — CID 146859536
N-[(3-chlorophenyl)methyl]-4'-(trifluoromethyl)spiro[1,4-dihydroquinoline-3,1'-cyclohexane]-2-imine (PubChem CID 146859536) has the molecular formula C22H22ClF3N2 and a molecular weight of 406.88 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-4'-(trifluoromethyl)spiro[1,4-dihydroquinoline-3,1'-cyclohexane]-2-imine.
| Compound Name | N-[(3-chlorophenyl)methyl]-4'-(trifluoromethyl)spiro[1,4-dihydroquinoline-3,1'-cyclohexane]-2-imine |
|---|---|
| PubChem CID | 146859536 |
| Molecular Formula | C22H22ClF3N2 |
| Molecular Weight | 406.88 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-4'-(trifluoromethyl)spiro[1,4-dihydroquinoline-3,1'-cyclohexane]-2-imine |
| SMILES | FC(F)(F)C1CCC2(CC1)Cc1ccccc1N/C2=N\Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H22ClF3N2/c23-18-6-3-4-15(12-18)14-27-20-21(10-8-17(9-11-21)22(24,25)26)13-16-5-1-2-7-19(16)28-20/h1-7,12,17H,8-11,13-14H2,(H,27,28) |
| InChIKey | SKGYSYHACOHAMK-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.88 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|