C24H35FN2O5S — CID 146861116
1-[5-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-3,3-dimethylbutyl]sulfonylpentyl]imidazolidine-2,4-dione (PubChem CID 146861116) has the molecular formula C24H35FN2O5S and a molecular weight of 482.62 g/mol. Its IUPAC name is 1-[5-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-3,3-dimethylbutyl]sulfonylpentyl]imidazolidine-2,4-dione.
| Compound Name | 1-[5-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-3,3-dimethylbutyl]sulfonylpentyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146861116 |
| Molecular Formula | C24H35FN2O5S |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 1-[5-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-3,3-dimethylbutyl]sulfonylpentyl]imidazolidine-2,4-dione |
| SMILES | CC(C)(C)C(CS(=O)(=O)CCCCCN1CC(=O)NC1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C24H35FN2O5S/c1-24(2,3)19(18-9-10-20(25)21(13-18)32-15-17-7-8-17)16-33(30,31)12-6-4-5-11-27-14-22(28)26-23(27)29/h9-10,13,17,19H,4-8,11-12,14-16H2,1-3H3,(H,26,28,29) |
| InChIKey | SKRBPDHKQRUAQZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|