C11H15Cl2F3O2 — CID 14686121
ethyl 3-(2,2-dichloro-3,3,3-trifluoropropyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 14686121) has the molecular formula C11H15Cl2F3O2 and a molecular weight of 307.14 g/mol. Its IUPAC name is ethyl 3-(2,2-dichloro-3,3,3-trifluoropropyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | ethyl 3-(2,2-dichloro-3,3,3-trifluoropropyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 14686121 |
| Molecular Formula | C11H15Cl2F3O2 |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | ethyl 3-(2,2-dichloro-3,3,3-trifluoropropyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1C(CC(Cl)(Cl)C(F)(F)F)C1(C)C |
| InChI | InChI=1S/C11H15Cl2F3O2/c1-4-18-8(17)7-6(9(7,2)3)5-10(12,13)11(14,15)16/h6-7H,4-5H2,1-3H3 |
| InChIKey | OUHOJUMYLJFJFW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|