C29H35F3N2O — CID 146864145
(1S,3R)-1-[2,6-difluoro-4-(1-propylazetidin-3-yl)oxyphenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine (PubChem CID 146864145) has the molecular formula C29H35F3N2O and a molecular weight of 484.61 g/mol. Its IUPAC name is (1S,3R)-1-[2,6-difluoro-4-(1-propylazetidin-3-yl)oxyphenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine.
| Compound Name | (1S,3R)-1-[2,6-difluoro-4-(1-propylazetidin-3-yl)oxyphenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine |
|---|---|
| PubChem CID | 146864145 |
| Molecular Formula | C29H35F3N2O |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | (1S,3R)-1-[2,6-difluoro-4-(1-propylazetidin-3-yl)oxyphenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine |
| SMILES | CCCN1CC(Oc2cc(F)c([C@@H]3C4=C(C[C@@H](C)N3CC(C)(C)F)c3ccccc3C4)c(F)c2)C1 |
| InChI | InChI=1S/C29H35F3N2O/c1-5-10-33-15-21(16-33)35-20-13-25(30)27(26(31)14-20)28-24-12-19-8-6-7-9-22(19)23(24)11-18(2)34(28)17-29(3,4)32/h6-9,13-14,18,21,28H,5,10-12,15-17H2,1-4H3/t18-,28+/m1/s1 |
| InChIKey | SLKQTZRWKBPRLK-WRHNGFHOSA-N |
| XLogP | 6.33 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |