C32H22F2N6O4 — CID 146864285
2-[6,8-difluoro-3-[(1S)-1-[1-(2-oxopropyl)-5-pyrazol-1-ylindazol-6-yl]ethoxy]quinolin-2-yl]isoindole-1,3-dione (PubChem CID 146864285) has the molecular formula C32H22F2N6O4 and a molecular weight of 592.56 g/mol. Its IUPAC name is 2-[6,8-difluoro-3-[(1S)-1-[1-(2-oxopropyl)-5-pyrazol-1-ylindazol-6-yl]ethoxy]quinolin-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[6,8-difluoro-3-[(1S)-1-[1-(2-oxopropyl)-5-pyrazol-1-ylindazol-6-yl]ethoxy]quinolin-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146864285 |
| Molecular Formula | C32H22F2N6O4 |
| Molecular Weight | 592.56 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | 2-[6,8-difluoro-3-[(1S)-1-[1-(2-oxopropyl)-5-pyrazol-1-ylindazol-6-yl]ethoxy]quinolin-2-yl]isoindole-1,3-dione |
| SMILES | CC(=O)Cn1ncc2cc(-n3cccn3)c([C@H](C)Oc3cc4cc(F)cc(F)c4nc3N3C(=O)c4ccccc4C3=O)cc21 |
| InChI | InChI=1S/C32H22F2N6O4/c1-17(41)16-39-26-14-24(27(11-20(26)15-36-39)38-9-5-8-35-38)18(2)44-28-12-19-10-21(33)13-25(34)29(19)37-30(28)40-31(42)22-6-3-4-7-23(22)32(40)43/h3-15,18H,16H2,1-2H3/t18-/m0/s1 |
| InChIKey | SLNXGCDZBZBYBO-SFHVURJKSA-N |
| XLogP | 5.58 |
| TPSA | 112.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|