C19H24N4O5 — CID 146865607
(2R,3R,6E)-3-(3-aminopropylcarbamoyloxymethyl)-3-methyl-7-oxo-6-(pyridin-2-ylmethylidene)-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 146865607) has the molecular formula C19H24N4O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is (2R,3R,6E)-3-(3-aminopropylcarbamoyloxymethyl)-3-methyl-7-oxo-6-(pyridin-2-ylmethylidene)-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2R,3R,6E)-3-(3-aminopropylcarbamoyloxymethyl)-3-methyl-7-oxo-6-(pyridin-2-ylmethylidene)-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 146865607 |
| Molecular Formula | C19H24N4O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (2R,3R,6E)-3-(3-aminopropylcarbamoyloxymethyl)-3-methyl-7-oxo-6-(pyridin-2-ylmethylidene)-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | C[C@@]1(COC(=O)NCCCN)CC2/C(=C\c3ccccn3)C(=O)N2[C@H]1C(=O)O |
| InChI | InChI=1S/C19H24N4O5/c1-19(11-28-18(27)22-8-4-6-20)10-14-13(9-12-5-2-3-7-21-12)16(24)23(14)15(19)17(25)26/h2-3,5,7,9,14-15H,4,6,8,10-11,20H2,1H3,(H,22,27)(H,25,26)/b13-9+/t14?,15-,19-/m0/s1 |
| InChIKey | SLUPLIKXHLTMIU-LIXXIBLUSA-N |
| XLogP | 0.61 |
| TPSA | 134.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|