C30H35I2N8O2- — CID 146866910
CID 146866910 (PubChem CID 146866910) has the molecular formula C30H35I2N8O2- and a molecular weight of 793.47 g/mol.
| Compound Name | CID 146866910 |
|---|---|
| PubChem CID | 146866910 |
| Molecular Formula | C30H35I2N8O2- |
| Molecular Weight | 793.47 g/mol |
| Exact Mass | 793.10 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N1CCN(c2nc(NCI3CN(C)C[I-]O3)nc3c2CCN(c2cccc4ccccc24)C3)C[C@@H]1CC#N |
| InChI | InChI=1S/C30H35I2N8O2/c1-3-28(41)40-16-15-39(17-23(40)11-13-33)29-25-12-14-38(27-10-6-8-22-7-4-5-9-24(22)27)18-26(25)35-30(36-29)34-20-32-21-37(2)19-31-42-32/h3-10,23H,1,11-12,14-21H2,2H3,(H,34,35,36)/q-1/t23-/m0/s1 |
| InChIKey | MGGNFLKMXJWNDA-QHCPKHFHSA-N |
| XLogP | 0.98 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.47 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|