About 7-amino-2-phenyl-1H-1,8-naphthyridin-4-one
7-amino-2-phenyl-1H-1,8-naphthyridin-4-one (PubChem CID 14686958) has the molecular formula C14H11N3O
and a molecular weight of 237.26 g/mol. Its IUPAC name is 7-amino-2-phenyl-1H-1,8-naphthyridin-4-one.
Molecular Properties
| Compound Name | 7-amino-2-phenyl-1H-1,8-naphthyridin-4-one |
| PubChem CID | 14686958 |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 7-amino-2-phenyl-1H-1,8-naphthyridin-4-one |
| SMILES | Nc1ccc2c(=O)cc(-c3ccccc3)[nH]c2n1 |
| InChI | InChI=1S/C14H11N3O/c15-13-7-6-10-12(18)8-11(16-14(10)17-13)9-4-2-1-3-5-9/h1-8H,(H3,15,16,17,18) |
| InChIKey | JFABDXYOYFAMJL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-amino-2-phenyl-1H-1,8-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-2-phenyl-1H-1,8-naphthyridin-4-one?
The IUPAC name of 7-amino-2-phenyl-1H-1,8-naphthyridin-4-one (CID 14686958) is 7-amino-2-phenyl-1H-1,8-naphthyridin-4-one.
What is the SMILES notation for 7-amino-2-phenyl-1H-1,8-naphthyridin-4-one?
The canonical SMILES for 7-amino-2-phenyl-1H-1,8-naphthyridin-4-one is Nc1ccc2c(=O)cc(-c3ccccc3)[nH]c2n1.
What is the InChIKey of 7-amino-2-phenyl-1H-1,8-naphthyridin-4-one?
The InChIKey is JFABDXYOYFAMJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O/c15-13-7-6-10-12(18)8-11(16-14(10)17-13)9-4-2-1-3-5-9/h1-8H,(H3,15,16,17,18).
What are the key properties of 7-amino-2-phenyl-1H-1,8-naphthyridin-4-one?
7-amino-2-phenyl-1H-1,8-naphthyridin-4-one has a molecular weight of 237.26 g/mol, XLogP of 2.17, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-2-phenyl-1H-1,8-naphthyridin-4-one is sourced from PubChem (CID 14686958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).