C14H17N3OS — CID 14687043
trans-(1R,2R)-2-(5-anilino-1,3,4-thiadiazol-2-yl)cyclohexan-1-ol (PubChem CID 14687043) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is trans-(1R,2R)-2-(5-anilino-1,3,4-thiadiazol-2-yl)cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-(5-anilino-1,3,4-thiadiazol-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 14687043 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | trans-(1R,2R)-2-(5-anilino-1,3,4-thiadiazol-2-yl)cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@H]1c1nnc(Nc2ccccc2)s1 |
| InChI | InChI=1S/C14H17N3OS/c18-12-9-5-4-8-11(12)13-16-17-14(19-13)15-10-6-2-1-3-7-10/h1-3,6-7,11-12,18H,4-5,8-9H2,(H,15,17)/t11-,12-/m1/s1 |
| InChIKey | BTKLYIAUXKZPOJ-VXGBXAGGSA-N |
| XLogP | 3.30 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |