About 3-butyl-5,6-dihydro-3H-2-benzofuran-1-one
3-butyl-5,6-dihydro-3H-2-benzofuran-1-one (PubChem CID 146874331) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-butyl-5,6-dihydro-3H-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 3-butyl-5,6-dihydro-3H-2-benzofuran-1-one |
| PubChem CID | 146874331 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 3-butyl-5,6-dihydro-3H-2-benzofuran-1-one |
| SMILES | CCCCC1OC(=O)C2=CCCC=C21 |
| InChI | InChI=1S/C12H16O2/c1-2-3-8-11-9-6-4-5-7-10(9)12(13)14-11/h6-7,11H,2-5,8H2,1H3 |
| InChIKey | SPFAXOGBVLWIAN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butyl-5,6-dihydro-3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-5,6-dihydro-3H-2-benzofuran-1-one?
The IUPAC name of 3-butyl-5,6-dihydro-3H-2-benzofuran-1-one (CID 146874331) is 3-butyl-5,6-dihydro-3H-2-benzofuran-1-one.
What is the SMILES notation for 3-butyl-5,6-dihydro-3H-2-benzofuran-1-one?
The canonical SMILES for 3-butyl-5,6-dihydro-3H-2-benzofuran-1-one is CCCCC1OC(=O)C2=CCCC=C21.
What is the InChIKey of 3-butyl-5,6-dihydro-3H-2-benzofuran-1-one?
The InChIKey is SPFAXOGBVLWIAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-2-3-8-11-9-6-4-5-7-10(9)12(13)14-11/h6-7,11H,2-5,8H2,1H3.
What are the key properties of 3-butyl-5,6-dihydro-3H-2-benzofuran-1-one?
3-butyl-5,6-dihydro-3H-2-benzofuran-1-one has a molecular weight of 192.26 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-5,6-dihydro-3H-2-benzofuran-1-one is sourced from PubChem (CID 146874331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).