C22H35FN4 — CID 146877597
2-butyl-7-[6-(4-fluoropiperidin-1-yl)hexyl]-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 146877597) has the molecular formula C22H35FN4 and a molecular weight of 374.55 g/mol. Its IUPAC name is 2-butyl-7-[6-(4-fluoropiperidin-1-yl)hexyl]-5H-cyclopenta[d]pyrimidin-4-amine.
| Compound Name | 2-butyl-7-[6-(4-fluoropiperidin-1-yl)hexyl]-5H-cyclopenta[d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146877597 |
| Molecular Formula | C22H35FN4 |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | 2-butyl-7-[6-(4-fluoropiperidin-1-yl)hexyl]-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | CCCCc1nc(N)c2c(n1)C(CCCCCCN1CCC(F)CC1)=CC2 |
| InChI | InChI=1S/C22H35FN4/c1-2-3-9-20-25-21-17(10-11-19(21)22(24)26-20)8-6-4-5-7-14-27-15-12-18(23)13-16-27/h10,18H,2-9,11-16H2,1H3,(H2,24,25,26) |
| InChIKey | SQVCDXISPBTFAW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|