C28H28F2N8 — CID 146878132
4-[4-[5-[(2,4-difluorophenyl)methyl]pyrimidin-2-yl]piperazin-1-yl]-N-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3,5-triazin-2-amine (PubChem CID 146878132) has the molecular formula C28H28F2N8 and a molecular weight of 514.58 g/mol. Its IUPAC name is 4-[4-[5-[(2,4-difluorophenyl)methyl]pyrimidin-2-yl]piperazin-1-yl]-N-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-[4-[5-[(2,4-difluorophenyl)methyl]pyrimidin-2-yl]piperazin-1-yl]-N-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 146878132 |
| Molecular Formula | C28H28F2N8 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 4-[4-[5-[(2,4-difluorophenyl)methyl]pyrimidin-2-yl]piperazin-1-yl]-N-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3,5-triazin-2-amine |
| SMILES | Fc1ccc(Cc2cnc(N3CCN(c4ncnc(Nc5ccc6c(c5)CCCC6)n4)CC3)nc2)c(F)c1 |
| InChI | InChI=1S/C28H28F2N8/c29-23-7-5-22(25(30)15-23)13-19-16-31-27(32-17-19)37-9-11-38(12-10-37)28-34-18-33-26(36-28)35-24-8-6-20-3-1-2-4-21(20)14-24/h5-8,14-18H,1-4,9-13H2,(H,33,34,35,36) |
| InChIKey | SRAFZCSTPWRBAK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |