C14H26O — CID 14687820
2,3,3a,4,5,6,7,8,9,10,11,12,13,13a-tetradecahydrocyclododeca[b]furan (PubChem CID 14687820) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,8,9,10,11,12,13,13a-tetradecahydrocyclododeca[b]furan.
| Compound Name | 2,3,3a,4,5,6,7,8,9,10,11,12,13,13a-tetradecahydrocyclododeca[b]furan |
|---|---|
| PubChem CID | 14687820 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 2,3,3a,4,5,6,7,8,9,10,11,12,13,13a-tetradecahydrocyclododeca[b]furan |
| SMILES | C1CCCCCC2OCCC2CCCC1 |
| InChI | InChI=1S/C14H26O/c1-2-4-6-8-10-14-13(11-12-15-14)9-7-5-3-1/h13-14H,1-12H2 |
| InChIKey | BXUHYORBIXEKMH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |