C12H18 — CID 14688277
1-cyclopenta-1,3-dien-1-yl-1-methylcyclohexane (PubChem CID 14688277) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yl-1-methylcyclohexane.
| Compound Name | 1-cyclopenta-1,3-dien-1-yl-1-methylcyclohexane |
|---|---|
| PubChem CID | 14688277 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-yl-1-methylcyclohexane |
| SMILES | CC1(C2=CC=CC2)CCCCC1 |
| InChI | InChI=1S/C12H18/c1-12(9-5-2-6-10-12)11-7-3-4-8-11/h3-4,7H,2,5-6,8-10H2,1H3 |
| InChIKey | YIIQXPNPQDTTNU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |