About 1-methyl-1-(3-propan-2-ylidenecyclopenta-1,4-dien-1-yl)cyclohexane
1-methyl-1-(3-propan-2-ylidenecyclopenta-1,4-dien-1-yl)cyclohexane (PubChem CID 14688282) has the molecular formula C15H22
and a molecular weight of 202.34 g/mol. Its IUPAC name is 1-methyl-1-(3-propan-2-ylidenecyclopenta-1,4-dien-1-yl)cyclohexane.
Molecular Properties
| Compound Name | 1-methyl-1-(3-propan-2-ylidenecyclopenta-1,4-dien-1-yl)cyclohexane |
| PubChem CID | 14688282 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 1-methyl-1-(3-propan-2-ylidenecyclopenta-1,4-dien-1-yl)cyclohexane |
| SMILES | CC(C)=C1C=CC(C2(C)CCCCC2)=C1 |
| InChI | InChI=1S/C15H22/c1-12(2)13-7-8-14(11-13)15(3)9-5-4-6-10-15/h7-8,11H,4-6,9-10H2,1-3H3 |
| InChIKey | FSYWBVYXZAJYLX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methyl-1-(3-propan-2-ylidenecyclopenta-1,4-dien-1-yl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-(3-propan-2-ylidenecyclopenta-1,4-dien-1-yl)cyclohexane?
The IUPAC name of 1-methyl-1-(3-propan-2-ylidenecyclopenta-1,4-dien-1-yl)cyclohexane (CID 14688282) is 1-methyl-1-(3-propan-2-ylidenecyclopenta-1,4-dien-1-yl)cyclohexane.
What is the SMILES notation for 1-methyl-1-(3-propan-2-ylidenecyclopenta-1,4-dien-1-yl)cyclohexane?
The canonical SMILES for 1-methyl-1-(3-propan-2-ylidenecyclopenta-1,4-dien-1-yl)cyclohexane is CC(C)=C1C=CC(C2(C)CCCCC2)=C1.
What is the InChIKey of 1-methyl-1-(3-propan-2-ylidenecyclopenta-1,4-dien-1-yl)cyclohexane?
The InChIKey is FSYWBVYXZAJYLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22/c1-12(2)13-7-8-14(11-13)15(3)9-5-4-6-10-15/h7-8,11H,4-6,9-10H2,1-3H3.
What are the key properties of 1-methyl-1-(3-propan-2-ylidenecyclopenta-1,4-dien-1-yl)cyclohexane?
1-methyl-1-(3-propan-2-ylidenecyclopenta-1,4-dien-1-yl)cyclohexane has a molecular weight of 202.34 g/mol, XLogP of 4.79, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-(3-propan-2-ylidenecyclopenta-1,4-dien-1-yl)cyclohexane is sourced from PubChem (CID 14688282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).