C21H23NO3 — CID 14688339
benzyl N-[(2-oxocyclohexyl)-phenylmethyl]carbamate (PubChem CID 14688339) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is benzyl N-[(2-oxocyclohexyl)-phenylmethyl]carbamate.
| Compound Name | benzyl N-[(2-oxocyclohexyl)-phenylmethyl]carbamate |
|---|---|
| PubChem CID | 14688339 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | benzyl N-[(2-oxocyclohexyl)-phenylmethyl]carbamate |
| SMILES | O=C(NC(c1ccccc1)C1CCCCC1=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H23NO3/c23-19-14-8-7-13-18(19)20(17-11-5-2-6-12-17)22-21(24)25-15-16-9-3-1-4-10-16/h1-6,9-12,18,20H,7-8,13-15H2,(H,22,24) |
| InChIKey | OARXJLBVEGMILY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |