About 4-imino-2-methoxy-3-methyl-7H-thieno[3,2-c]pyridin-6-one
4-imino-2-methoxy-3-methyl-7H-thieno[3,2-c]pyridin-6-one (PubChem CID 146886137) has the molecular formula C9H10N2O2S
and a molecular weight of 210.26 g/mol. Its IUPAC name is 4-imino-2-methoxy-3-methyl-7H-thieno[3,2-c]pyridin-6-one.
Molecular Properties
| Compound Name | 4-imino-2-methoxy-3-methyl-7H-thieno[3,2-c]pyridin-6-one |
| PubChem CID | 146886137 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 4-imino-2-methoxy-3-methyl-7H-thieno[3,2-c]pyridin-6-one |
| SMILES | [H]/N=C1\NC(=O)Cc2sc(OC)c(C)c21 |
| InChI | InChI=1S/C9H10N2O2S/c1-4-7-5(14-9(4)13-2)3-6(12)11-8(7)10/h3H2,1-2H3,(H2,10,11,12) |
| InChIKey | SWVJDUOPIBQUMS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-imino-2-methoxy-3-methyl-7H-thieno[3,2-c]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imino-2-methoxy-3-methyl-7H-thieno[3,2-c]pyridin-6-one?
The IUPAC name of 4-imino-2-methoxy-3-methyl-7H-thieno[3,2-c]pyridin-6-one (CID 146886137) is 4-imino-2-methoxy-3-methyl-7H-thieno[3,2-c]pyridin-6-one.
What is the SMILES notation for 4-imino-2-methoxy-3-methyl-7H-thieno[3,2-c]pyridin-6-one?
The canonical SMILES for 4-imino-2-methoxy-3-methyl-7H-thieno[3,2-c]pyridin-6-one is [H]/N=C1\NC(=O)Cc2sc(OC)c(C)c21.
What is the InChIKey of 4-imino-2-methoxy-3-methyl-7H-thieno[3,2-c]pyridin-6-one?
The InChIKey is SWVJDUOPIBQUMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2S/c1-4-7-5(14-9(4)13-2)3-6(12)11-8(7)10/h3H2,1-2H3,(H2,10,11,12).
What are the key properties of 4-imino-2-methoxy-3-methyl-7H-thieno[3,2-c]pyridin-6-one?
4-imino-2-methoxy-3-methyl-7H-thieno[3,2-c]pyridin-6-one has a molecular weight of 210.26 g/mol, XLogP of 1.06, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imino-2-methoxy-3-methyl-7H-thieno[3,2-c]pyridin-6-one is sourced from PubChem (CID 146886137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).